59488-34-5 Usage
General Description
4-Bromo-2-Nitrophenylhydrazine is a chemical compound with the formula C6H5BrN3O2. It is a yellow crystalline solid that is commonly used in the synthesis of organic compounds and pharmaceuticals. The compound is known for its ability to react with carbonyl compounds to form hydrazones, making it a valuable tool in organic chemistry. It is also used as a reagent to detect ketones and aldehydes in various chemical reactions. Additionally, 4-Bromo-2-Nitrophenylhydrazine has potential applications in biological research and medical diagnostics due to its ability to selectively bind with certain biological molecules. Overall, this compound plays a crucial role in various chemical and biological processes and is a valuable tool in laboratory settings.
Check Digit Verification of cas no
The CAS Registry Mumber 59488-34-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,4,8 and 8 respectively; the second part has 2 digits, 3 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 59488-34:
(7*5)+(6*9)+(5*4)+(4*8)+(3*8)+(2*3)+(1*4)=175
175 % 10 = 5
So 59488-34-5 is a valid CAS Registry Number.
InChI:InChI=1/C6H6BrN3O2/c7-4-1-2-5(9-8)6(3-4)10(11)12/h1-3,9H,8H2
59488-34-5Relevant articles and documents
INHIBITORS OF VAP-1
-
Paragraph 0686, (2020/05/12)
Provided herein are compounds and methods of use thereof for the modulation of VAP-1 activity.
