59548-39-9 Usage
Description
4-METHOXY-O-PHENYLENEDIAMINE DIHYDROCHLORIDE is an organic compound that serves as a crucial intermediate in the synthesis of various heterocyclic compounds and pharmaceuticals. It is characterized by its chemical structure, which includes a phenyl ring with a diamine group and a methoxy group, and is commonly used in the field of organic synthesis.
Uses
Used in Organic Synthesis:
4-METHOXY-O-PHENYLENEDIAMINE DIHYDROCHLORIDE is used as a key intermediate for the synthesis of other heterocyclic compounds. Its unique chemical structure allows it to participate in various chemical reactions, making it a valuable building block in the creation of complex organic molecules.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-METHOXY-O-PHENYLENEDIAMINE DIHYDROCHLORIDE is used as a precursor for the development of new drugs. Its versatile chemical properties enable it to be incorporated into the structures of various pharmaceutical compounds, potentially leading to the discovery of novel therapeutic agents.
Used in Analytical Chemistry:
4-METHOXY-O-PHENYLENEDIAMINE DIHYDROCHLORIDE is used as a derivatizing reagent in the determination of glyoxal, methylglyoxal, and diacetyl in urine samples through High-performance liquid chromatography (HPLC). Its ability to react with these specific compounds allows for accurate and sensitive detection, which is essential in various medical and research applications.
Check Digit Verification of cas no
The CAS Registry Mumber 59548-39-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,5,4 and 8 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 59548-39:
(7*5)+(6*9)+(5*5)+(4*4)+(3*8)+(2*3)+(1*9)=169
169 % 10 = 9
So 59548-39-9 is a valid CAS Registry Number.
InChI:InChI=1/C7H10N2O.2ClH/c1-10-5-2-3-6(8)7(9)4-5;;/h2-4H,8-9H2,1H3;2*1H
