59549-52-9 Usage
Description
5-BROMO-2-METHOXY-4-(METHYLTHIO)PYRIMIDINE is a pyrimidine derivative with the molecular formula C6H6BrN2O2S. It is characterized by the presence of a bromine atom, a methoxy group, and a methylthio group. This chemical compound has potential applications in organic synthesis and pharmaceutical research due to its unique structure and properties.
Uses
Used in Organic Synthesis:
5-BROMO-2-METHOXY-4-(METHYLTHIO)PYRIMIDINE is used as a building block in the synthesis of various pharmaceutical compounds and agrochemicals. Its unique structure allows for the creation of a wide range of molecules with different properties and applications.
Used in Pharmaceutical Research:
5-BROMO-2-METHOXY-4-(METHYLTHIO)PYRIMIDINE is used as a starting material for the development of new drugs. Its potential biological and pharmacological activities have been studied, making it a valuable compound for research in the pharmaceutical industry.
Used in Agrochemicals:
5-BROMO-2-METHOXY-4-(METHYLTHIO)PYRIMIDINE is also used in the synthesis of agrochemicals, contributing to the development of new products for agricultural applications.
Check Digit Verification of cas no
The CAS Registry Mumber 59549-52-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,5,4 and 9 respectively; the second part has 2 digits, 5 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 59549-52:
(7*5)+(6*9)+(5*5)+(4*4)+(3*9)+(2*5)+(1*2)=169
169 % 10 = 9
So 59549-52-9 is a valid CAS Registry Number.
InChI:InChI=1/C6H7BrN2OS/c1-10-6-8-3-4(7)5(9-6)11-2/h3H,1-2H3
