59556-29-5 Usage
Explanation
The compound is derived from cyclohexadiene carboxylic acid, which is a central component in the biosynthesis of some important natural products.
3. 5-amino variation
Explanation
The presence of an amino group (-NH2) attached to the 5th carbon atom of the cyclohexadiene ring, which can influence the compound's reactivity and properties.
4. (5S) stereochemistry
Explanation
The (5S) designation indicates that the stereochemistry of the compound is oriented in a specific way, which can impact its biological activity and interactions with other molecules.
5. Potential applications
Explanation
Due to its unique structure and properties, the compound may have various potential uses in pharmaceuticals, organic synthesis, and research applications.
6. Chemical structure
Explanation
The compound has a cyclohexadiene ring with a carboxylic acid group (-COOH) at the 1st position and an amino group (-NH2) at the 5th position, with the stereochemistry at the 5th position being (5S).
7. Biological activity
Explanation
The specific stereochemistry and functional groups present in the compound may contribute to its biological activity, making it a potential candidate for further study in the development of pharmaceuticals or other biologically active molecules.
8. Chirality
Explanation
The presence of the (5S) designation implies that the compound is chiral, meaning it has a non-superimposable mirror image. This can lead to different biological activities and interactions for each enantiomer.
Check Digit Verification of cas no
The CAS Registry Mumber 59556-29-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,5,5 and 6 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 59556-29:
(7*5)+(6*9)+(5*5)+(4*5)+(3*6)+(2*2)+(1*9)=165
165 % 10 = 5
So 59556-29-5 is a valid CAS Registry Number.
InChI:InChI=1/C7H9NO2/c8-6-3-1-2-5(4-6)7(9)10/h1-3,6H,4,8H2,(H,9,10)/t6-/m1/s1
