59702-08-8 Usage
Description
1-Ethylpiperazin-2-one, also known as 1-ethyl-2-piperazinone, is an organic compound that serves as a key intermediate in the synthesis of various pharmaceutical compounds. It is a heterocyclic compound with a piperazine core, which is a common structural element in many drugs and biologically active molecules. Its chemical properties make it a versatile building block for the development of new therapeutic agents.
Uses
Used in Pharmaceutical Industry:
1-Ethylpiperazin-2-one is used as a synthetic intermediate for the production of piperidine and piperazine derivatives, which are known for their cognitive-enhancing properties. These derivatives have potential applications in the treatment of cognitive disorders and improving cognitive function in various conditions.
In the synthesis of these derivatives, 1-ethylpiperazin-2-one serves as a crucial component, allowing for the development of new drugs with improved efficacy and safety profiles. Its role in the pharmaceutical industry is essential for the advancement of novel therapeutic agents targeting cognitive impairments and related conditions.
Check Digit Verification of cas no
The CAS Registry Mumber 59702-08-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,7,0 and 2 respectively; the second part has 2 digits, 0 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 59702-08:
(7*5)+(6*9)+(5*7)+(4*0)+(3*2)+(2*0)+(1*8)=138
138 % 10 = 8
So 59702-08-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N2O/c1-2-8-4-3-7-5-6(8)9/h7H,2-5H2,1H3
59702-08-8Relevant articles and documents
PYRAZOLOPYRIMIDINE COMPOUNDS AS KINASE INHIBITORS
-
Page/Page column 89, (2014/03/26)
The present disclosure provides compounds of Formula (LA) and/ or pharmaceutically acceptable salts thereof that are tyrosine kinase inhibitors, in particular BTK, and are potentially useful for the treatment of diseases treatable by inhibition of ty r-osine kinases such as cancer, inflammatory diseases such as arthritis, and the like. Also provided are pharmaceutical compositions containing such compounds and/or pharmaceutically acceptable salts thereof and processes for preparing such compounds and p h ar-maceutically acceptable salts thereof