59718-84-2 Usage
Description
METHYL 3-METHYLPYRIDINE-2-CARBOXYLATE, also known as Methyl 3-Methylnicotinate, is an organic compound that serves as a crucial building block in the synthesis of various chemical compounds. It is a colorless liquid with unique chemical properties that make it valuable in the pharmaceutical and chemical industries.
Uses
Used in Pharmaceutical Industry:
METHYL 3-METHYLPYRIDINE-2-CARBOXYLATE is used as a building block for the synthesis of pyrrolo[3,4-b]pyridin-7(6H)-one derivatives, which are known as melanin concentrating hormone receptor 1 (MCH-R1) antagonists. These antagonists play a significant role in the development of potential treatments for various conditions, including obesity and other metabolic disorders, by targeting and blocking the MCH-R1 receptors.
Used in Chemical Synthesis:
METHYL 3-METHYLPYRIDINE-2-CARBOXYLATE is also used as an intermediate in the synthesis of other complex organic compounds, contributing to the development of new materials and products in the chemical industry. Its unique structure and properties make it a versatile component in the creation of various chemical entities with potential applications in different fields.
Check Digit Verification of cas no
The CAS Registry Mumber 59718-84-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 5,9,7,1 and 8 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 59718-84:
(7*5)+(6*9)+(5*7)+(4*1)+(3*8)+(2*8)+(1*4)=172
172 % 10 = 2
So 59718-84-2 is a valid CAS Registry Number.
InChI:InChI=1/C8H9NO2/c1-6-4-3-5-9-7(6)8(10)11-2/h3-5H,1-2H3
