60093-10-9 Usage
General Description
3-AMINO-5-METHYLTHIO-1,2,4-THIADIAZOLE is a chemical compound with the molecular formula C3H4N2S2. It is a heterocyclic organic compound that contains a five-membered ring structure consisting of two nitrogen atoms, one sulfur atom, and two carbon atoms. 3-AMINO-5-METHYLTHIO-1,2,4-THIADIAZOLE is commonly used in pharmaceutical and agricultural industries as an intermediate for the synthesis of various drugs and pesticides. It is also known for its potential biological activities, including antimicrobial and antifungal properties. Additionally, 3-AMINO-5-METHYLTHIO-1,2,4-THIADIAZOLE can be utilized in the synthesis of novel materials and can serve as a building block for the creation of new chemical compounds with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 60093-10-9 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,0,9 and 3 respectively; the second part has 2 digits, 1 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 60093-10:
(7*6)+(6*0)+(5*0)+(4*9)+(3*3)+(2*1)+(1*0)=89
89 % 10 = 9
So 60093-10-9 is a valid CAS Registry Number.
InChI:InChI=1/C3H5N3S2/c1-7-3-5-2(4)6-8-3/h1H3,(H2,4,6)