6033-87-0 Usage
Description
Carbazole potassium salt, a chemical compound derived from carbazole, is a versatile and valuable substance in the field of organic chemistry. It possesses unique properties that make it suitable for a variety of applications, particularly in the development of advanced materials and devices.
Uses
Used in Organic Electroluminescent Devices:
Carbazole potassium salt is used as a precursor for the preparation of carbene compounds, which are essential components in the development of organic electroluminescent devices. These devices have a wide range of applications, including display technologies, lighting systems, and advanced communication systems, due to their high efficiency, low power consumption, and potential for flexible design.
In the field of organic chemistry and materials science, Carbazole potassium salt plays a crucial role in the synthesis of carbene compounds, which are vital for the advancement of organic electroluminescent devices. These devices are increasingly being utilized in various industries, such as electronics, telecommunications, and automotive, due to their numerous advantages over traditional inorganic counterparts.
Check Digit Verification of cas no
The CAS Registry Mumber 6033-87-0 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,0,3 and 3 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 6033-87:
(6*6)+(5*0)+(4*3)+(3*3)+(2*8)+(1*7)=80
80 % 10 = 0
So 6033-87-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H8N.K/c1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;/h1-8H;/q-1;+1
