6057-48-3 Usage
Description
3-O-BETA-D-GALACTO-PYRANOSYL-D-ARABINOSE is a disaccharide composed of aldehydo-D-arabinose with a beta-D-galactopyranosyl residue at the 3-position. It is a complex carbohydrate structure that plays a significant role in various biological processes and has potential applications in different industries.
Uses
Used in Pharmaceutical Industry:
3-O-BETA-D-GALACTO-PYRANOSYL-D-ARABINOSE is used as a pharmaceutical compound for its potential therapeutic properties. The disaccharide structure allows it to interact with specific receptors and enzymes, making it a promising candidate for the development of new drugs targeting various diseases.
Used in Biotechnology Industry:
In the biotechnology sector, 3-O-BETA-D-GALACTO-PYRANOSYL-D-ARABINOSE is used as a key component in the development of bioactive molecules and biomaterials. Its unique structure enables it to be incorporated into various biotechnological applications, such as the creation of novel vaccines, drug delivery systems, and tissue engineering scaffolds.
Used in Food Industry:
3-O-BETA-D-GALACTO-PYRANOSYL-D-ARABINOSE can be utilized in the food industry as a natural sweetener or as an ingredient in the development of functional foods. Its disaccharide structure may provide health benefits, such as promoting gut health and enhancing the immune system.
Used in Cosmetics Industry:
In the cosmetics industry, 3-O-BETA-D-GALACTO-PYRANOSYL-D-ARABINOSE may be used as an active ingredient in skincare products due to its potential moisturizing, anti-aging, and skin-protective properties. Its ability to interact with skin cells and proteins could lead to the development of innovative cosmetic formulations.
Used in Research and Development:
3-O-BETA-D-GALACTO-PYRANOSYL-D-ARABINOSE is also used in research and development for its potential applications in various scientific fields. Its unique disaccharide structure makes it an interesting subject for studying carbohydrate chemistry, glycobiology, and the development of new bioactive compounds.
Check Digit Verification of cas no
The CAS Registry Mumber 6057-48-3 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,0,5 and 7 respectively; the second part has 2 digits, 4 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 6057-48:
(6*6)+(5*0)+(4*5)+(3*7)+(2*4)+(1*8)=93
93 % 10 = 3
So 6057-48-3 is a valid CAS Registry Number.
InChI:InChI=1/C11H20O10/c12-1-4(15)10(5(16)2-13)21-11-9(19)8(18)7(17)6(3-14)20-11/h1,4-11,13-19H,2-3H2/t4-,5-,6-,7+,8+,9-,10+,11+/m1/s1
6057-48-3Relevant articles and documents
Characterization of a laminaribiose phosphorylase from Acholeplasma laidlawii PG-8A and production of 1,3-β-d-glucosyl disaccharides
Nihira, Takanori,Saito, Yuka,Kitaoka, Motomitsu,Nishimoto, Mamoru,Otsubo, Ken'Ichi,Nakai, Hiroyuki
, p. 49 - 54 (2013/01/15)
We identified a glycoside hydrolase family 94 homolog (ACL0729) from Acholeplasma laidlawii PG-8A as a laminaribiose (1,3-β-d-glucobiose) phosphorylase (EC 2.4.1.31). The recombinant ACL0729 produced in Escherichia coli catalyzed phosphorolysis of laminar
