60640-59-7 Usage
Description
1-Acetyloxy-2-hydroxy-12,15-heneicosadien-4-one is a long chain, unsaturated ketone oxide belonging to the class of organic compounds known as ketone oxides. It features acetyloxy and hydroxy functional groups attached to the main carbon chain and is also referred to as (4E,12E)-1-acetyloxy-2-hydroxy-12,15-heneicosadien-4-one. 1-Acetyloxy-2-hydroxy-12,15-heneicosadien-4-one has potential applications in medicinal chemistry due to its interesting biological activities and may also be utilized in the fragrance and flavor industry because of its unique chemical structure. However, further research is necessary to fully explore its properties and potential uses.
Uses
Used in Medicinal Chemistry:
1-Acetyloxy-2-hydroxy-12,15-heneicosadien-4-one is used as a compound with potential applications in medicinal chemistry for its interesting biological activities. Its unique structure and functional groups may contribute to the development of new pharmaceutical agents.
Used in Fragrance and Flavor Industry:
1-Acetyloxy-2-hydroxy-12,15-heneicosadien-4-one is used as a compound with potential applications in the fragrance and flavor industry due to its unique chemical structure. Its properties may be harnessed to create novel scents and flavors for various consumer products.
Further research is required to fully understand the properties and potential uses of 1-acetyloxy-2-hydroxy-12,15-heneicosadien-4-one, as its current applications are based on its potential and not yet fully realized.
Check Digit Verification of cas no
The CAS Registry Mumber 60640-59-7 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,6,4 and 0 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 60640-59:
(7*6)+(6*0)+(5*6)+(4*4)+(3*0)+(2*5)+(1*9)=107
107 % 10 = 7
So 60640-59-7 is a valid CAS Registry Number.
InChI:InChI=1/C23H40O4/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-22(25)19-23(26)20-27-21(2)24/h7-8,10-11,23,26H,3-6,9,12-20H2,1-2H3/b8-7+,11-10+