60834-67-5 Usage
Structure
A naphthalene ring with a hydroxyl (OH) group attached, two cyclopentyl groups, and four hydrogen atoms in a tetrahydro structure.
Functional Groups
Hydroxyl (OH), cyclopentyl, and tetrahydro.
Chemical Class
Naphthol derivative.
Potential Applications
Pharmaceuticals, agrochemicals, and material sciences.
Research and Testing
Further investigation required to determine specific uses and characteristics.
Solubility
Unknown, but may be influenced by the hydroxyl and cyclopentyl groups.
Stability
Unknown, but the presence of a hydroxyl group may affect reactivity.
Physical State
Likely a solid at room temperature, given the complexity of the molecular structure.
Melting Point
Unknown, but may be influenced by the molecular size and shape.
Boiling Point
Unknown, but likely high due to the molecular size and complexity.
Density
Unknown, but may be influenced by the molecular structure and mass.
Optical Properties
Unknown, but the presence of a naphthalene ring and cyclopentyl groups may affect light absorption and emission.
Reactivity
Unknown, but the hydroxyl group may participate in reactions such as esterification, etherification, and substitution.
Toxicity
Unknown, but further research is needed to determine potential hazards and safety precautions.
Check Digit Verification of cas no
The CAS Registry Mumber 60834-67-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,0,8,3 and 4 respectively; the second part has 2 digits, 6 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 60834-67:
(7*6)+(6*0)+(5*8)+(4*3)+(3*4)+(2*6)+(1*7)=125
125 % 10 = 5
So 60834-67-5 is a valid CAS Registry Number.
InChI:InChI=1/C20H28O/c21-20-18(14-7-1-2-8-14)13-16-11-5-6-12-17(16)19(20)15-9-3-4-10-15/h13-15,21H,1-12H2
