613676-70-3 Usage
General Description
3-(2-Phenylethyl)pyrrolidine is a chemical compound with the molecular formula C13H17N. It is a pyrrolidine derivative that contains a phenylethyl group, which gives it the characteristic odor of flowers. 3-(2-Phenylethyl)pyrrolidine is commonly used in the synthesis of various pharmaceuticals and other organic compounds. It has also been studied for its potential medicinal properties, including its ability to act as a therapeutic agent for a variety of conditions. Additionally, 3-(2-Phenylethyl)pyrrolidine has been investigated for its potential use in the development of new drugs and as a precursor for the synthesis of other chemical compounds. Overall, this chemical compound has a wide range of potential applications in the field of chemistry and pharmacology.
Check Digit Verification of cas no
The CAS Registry Mumber 613676-70-3 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,1,3,6,7 and 6 respectively; the second part has 2 digits, 7 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 613676-70:
(8*6)+(7*1)+(6*3)+(5*6)+(4*7)+(3*6)+(2*7)+(1*0)=163
163 % 10 = 3
So 613676-70-3 is a valid CAS Registry Number.
InChI:InChI=1/C12H17N/c1-2-4-11(5-3-1)6-7-12-8-9-13-10-12/h1-5,12-13H,6-10H2