6141-02-2 Usage
Description
2-Amino-4-methylquinazoline is a chemical compound with the molecular formula C10H9N3. It is a quinazoline derivative that contains both an amino group and a methyl group. This versatile compound has potential applications in various fields, including medicine, agriculture, and industry.
Uses
Used in Pharmaceutical Industry:
2-Amino-4-methylquinazoline is used as a building block for the synthesis of pharmaceuticals. Its unique structure allows for the development of new drugs with potential therapeutic benefits.
Used in Agrochemical Industry:
In the agrochemical industry, 2-Amino-4-methylquinazoline is used as a building block for the synthesis of agrochemicals. Its potential applications include the development of new pesticides and herbicides to improve crop protection and yield.
Used in Functional Materials:
2-Amino-4-methylquinazoline is used in the development of functional materials, such as organic light-emitting diodes (OLEDs) and other electronic devices, due to its unique chemical properties.
Used in Antitumor Applications:
2-Amino-4-methylquinazoline has shown potential as an antitumor agent. It is used for its cytotoxic activity against cancer cells, making it a promising candidate for further research and development in oncology.
Used in Corrosion Inhibition:
In industrial applications, 2-Amino-4-methylquinazoline has been investigated for its potential use as a corrosion inhibitor. Its ability to protect metal surfaces from corrosion can contribute to the longevity and maintenance of various industrial equipment and structures.
Check Digit Verification of cas no
The CAS Registry Mumber 6141-02-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,1,4 and 1 respectively; the second part has 2 digits, 0 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6141-02:
(6*6)+(5*1)+(4*4)+(3*1)+(2*0)+(1*2)=62
62 % 10 = 2
So 6141-02-2 is a valid CAS Registry Number.
InChI:InChI=1/C9H9N3/c1-6-7-4-2-3-5-8(7)12-9(10)11-6/h2-5H,1H3,(H2,10,11,12)