61563-24-4 Usage
Description
Isoquinoline, 7,9-dichloro-1,2,3,4-tetrahydrois a chemical compound belonging to the isoquinoline family. It is characterized by the presence of chloro substituents at the 7and 8-positions, which gives it unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
Isoquinoline, 7,9-dichloro-1,2,3,4-tetrahydrois used as an intermediate compound for the synthesis of various pharmaceuticals. Its unique chemical structure allows it to be a key component in the development of new drugs targeting specific medical conditions.
Used in Chemical Research:
Isoquinoline, 7,9-dichloro-1,2,3,4-tetrahydrois also utilized in chemical research as a model for studying the properties and reactivity of chloro-substituted isoquinolines. This can lead to a better understanding of their potential applications and the development of new synthetic methods.
Used in Material Science:
Isoquinoline, 7,9-dichloro-1,2,3,4-tetrahydromay have potential applications in the field of material science, particularly in the development of new materials with specific properties. Its unique structure could contribute to the creation of novel materials with enhanced performance characteristics.
Check Digit Verification of cas no
The CAS Registry Mumber 61563-24-4 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,5,6 and 3 respectively; the second part has 2 digits, 2 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 61563-24:
(7*6)+(6*1)+(5*5)+(4*6)+(3*3)+(2*2)+(1*4)=114
114 % 10 = 4
So 61563-24-4 is a valid CAS Registry Number.
InChI:InChI=1/C9H9Cl2N/c10-8-2-1-6-3-4-12-5-7(6)9(8)11/h1-2,12H,3-5H2
61563-24-4Relevant articles and documents
Inhibitors of phenylethanolamine N-methyltransferase and epinephrine biosynthesis: I. Chloro-substituted 1,2,3,4-tetrahydroisoquinolines
Bondinell,Chapin,Girard,Kaiser,Krog,Pavloff,Schwartz,Silvestri,Vaidya,Lam,Wellman,Pendleton
, p. 506 - 511 (2007/10/02)
In a search for inhibitors of epinephrine biosynthesis as potential therapeutic agents, a series of 13 ring-chlorinated 1,2,3,4-tetrahydroisoquinolines was prepared. These compounds were tested initially for their ability to inhibit rabbit adrenal phenylethanolamine N-methyltransferase (PNMT) in vitro. Enzyme-inhibitor dissociation constants, determined for the six most potent members of the series, indicated the following order of decreasing potency: 7,8-Cl2>6,7,8-Cl3>7-Cl~8-Cl>5,6,7,8-Cl4>5,7,8-Cl3. These compounds were subsequently examined for PNMT-inhibiting activity in intact rats and mice. 7,8-Dichloro-1,2,3,4-tetrahydroisoquinoline (SK&F 64139) was the most potent member of the series both in vitro and in vivo and is currently undergoing clinical investigation.
