61758-77-8 Usage
Description
Platinum, (1,2-cyclohexanediamine-N,N')(ethanedioato(2-)-o,o')-, (sp-4-2-(1S-trans))-, also known as (S,S) Oxaliplatin, is a third-generation platinum complex with potent antitumor activity. It is characterized by its unique structure, which allows it to form adducts with DNA, leading to cytotoxic effects and the inhibition of cancer cell growth.
Uses
Used in Anticancer Applications:
Platinum, (1,2-cyclohexanediamine-N,N')(ethanedioato(2-)-o,o')-, (sp-4-2-(1S-trans))is used as an antitumor agent for the treatment of colorectal cancer. Its mechanism of action involves the formation of DNA adducts, which disrupt cellular processes and inhibit tumor growth.
Used in Pharmaceutical Industry:
Platinum, (1,2-cyclohexanediamine-N,N')(ethanedioato(2-)-o,o')-, (sp-4-2-(1S-trans))is used as a key component in the development of antineoplastic drugs. Its unique properties and high efficacy against colorectal cancer make it a valuable asset in the fight against cancer.
Used in Research and Development:
Platinum, (1,2-cyclohexanediamine-N,N')(ethanedioato(2-)-o,o')-, (sp-4-2-(1S-trans))is also utilized in research and development for the discovery of new platinum-based compounds with potential applications in cancer treatment. Its success as an antitumor agent has inspired further investigation into the development of novel platinum complexes with improved properties and broader applications.
Check Digit Verification of cas no
The CAS Registry Mumber 61758-77-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,7,5 and 8 respectively; the second part has 2 digits, 7 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 61758-77:
(7*6)+(6*1)+(5*7)+(4*5)+(3*8)+(2*7)+(1*7)=148
148 % 10 = 8
So 61758-77-8 is a valid CAS Registry Number.
InChI:InChI=1/C6H12N2.C2H2O4.Pt/c7-5-3-1-2-4-6(5)8;3-1(4)2(5)6;/h5-8H,1-4H2;(H,3,4)(H,5,6);/q-2;;+2
