61827-59-6 Usage
General Description
1,3-Dibromo-4-methoxy-2-methyl-5-nitrobenzene is an aromatic, organic compound that is characterized by its combination of methoxy, nitro, bromo and methyl functional groups attached to a benzene ring, an aromatic hydrocarbon known for its stability. The presence of different functional groups signifies the molecule's potential for varied physical and chemical properties, including reactivity, polarity, phase of matter, color, and magnetic and electrical properties. Because of its complex structure, it can be involved in various types of chemical reactions. The compound is largely used in the field of synthetic organic chemistry, but its specific applications depend on how it's further manipulated chemically. It can be used in different industrial production processes or can serve as a building block for synthesizing more complex molecules.
Check Digit Verification of cas no
The CAS Registry Mumber 61827-59-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,1,8,2 and 7 respectively; the second part has 2 digits, 5 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 61827-59:
(7*6)+(6*1)+(5*8)+(4*2)+(3*7)+(2*5)+(1*9)=136
136 % 10 = 6
So 61827-59-6 is a valid CAS Registry Number.
InChI:InChI=1/C8H7Br2NO3/c1-4-5(9)3-6(11(12)13)8(14-2)7(4)10/h3H,1-2H3
