6287-79-2 Usage
Description
(3E)-2-(2,2-diphenylacetyl)-3-(propan-2-ylidenehydrazinylidene)inden-1-one is a complex chemical compound that features a diphenylacetyl group, a propan-2-ylidenehydrazinylidene group, and an inden-1-one group. Its three-dimensional structure is attributed to the double bonds and various substituents attached to the central core. (3E)-2-(2,2-diphenylacetyl)-3-(propan-2-ylidenehydrazinylidene)inden-1-one may hold potential for applications in organic synthesis, medicinal chemistry, or material science, although further research is necessary to fully explore its properties and uses.
Uses
Used in Organic Synthesis:
(3E)-2-(2,2-diphenylacetyl)-3-(propan-2-ylidenehydrazinylidene)inden-1-one is used as a key intermediate in organic synthesis for the creation of various complex organic molecules. Its unique structure allows for multiple points of reactivity, making it a versatile building block in the synthesis of pharmaceuticals, agrochemicals, and other specialty chemicals.
Used in Medicinal Chemistry:
In the field of medicinal chemistry, (3E)-2-(2,2-diphenylacetyl)-3-(propan-2-ylidenehydrazinylidene)inden-1-one is used as a potential lead compound for the development of new drugs. Its structural features may offer specific binding affinities to biological targets, such as enzymes or receptors, which could be harnessed to treat various diseases or medical conditions.
Used in Material Science:
(3E)-2-(2,2-diphenylacetyl)-3-(propan-2-ylidenehydrazinylidene)inden-1-one may also find applications in material science, where its structural properties could be exploited to develop new materials with unique characteristics. These materials could have potential uses in various industries, such as electronics, coatings, or advanced composites, depending on the compound's physical and chemical properties.
Further research is essential to fully understand the properties and potential uses of (3E)-2-(2,2-diphenylacetyl)-3-(propan-2-ylidenehydrazinylidene)inden-1-one, as its complex structure and reactivity may offer novel opportunities in various scientific and industrial fields.
Check Digit Verification of cas no
The CAS Registry Mumber 6287-79-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,2,8 and 7 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 6287-79:
(6*6)+(5*2)+(4*8)+(3*7)+(2*7)+(1*9)=122
122 % 10 = 2
So 6287-79-2 is a valid CAS Registry Number.
InChI:InChI=1/C26H22N2O2/c1-17(2)27-28-24-20-15-9-10-16-21(20)25(29)23(24)26(30)22(18-11-5-3-6-12-18)19-13-7-4-8-14-19/h3-16,22-23H,1-2H3/b28-24-