6304-91-2 Usage
Description
(2-benzylsulfanylethylideneamino)urea is a chemical compound with the molecular formula C12H16N2OS. It is a urea derivative featuring a benzylsulfanyl group attached to the ethylideneamino moiety. This unique structure endows it with potential biological activities and makes it a promising candidate in the field of medicinal chemistry and drug development.
Uses
Used in Medicinal Chemistry:
(2-benzylsulfanylethylideneamino)urea is used as a building block for the development of new pharmaceuticals due to its unique structure and potential biological activities.
Used in Drug Development:
(2-benzylsulfanylethylideneamino)urea is used as a precursor in the synthesis of novel compounds with potential therapeutic applications, contributing to the advancement of drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 6304-91-2 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,3,0 and 4 respectively; the second part has 2 digits, 9 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 6304-91:
(6*6)+(5*3)+(4*0)+(3*4)+(2*9)+(1*1)=82
82 % 10 = 2
So 6304-91-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H13N3OS/c11-10(14)13-12-6-7-15-8-9-4-2-1-3-5-9/h1-6H,7-8H2,(H3,11,13,14)/b12-6+
