635-86-9 Usage
Description
Gamma-glutamyl-2-naphthylamide, also known as H-Glu-βNA, is an L-glutamic acid derivative that is formed by the formal condensation of the alpha-carboxy group of L-glutamic acid with the amino group of 2-naphthylamine. It is a compound widely utilized in various applications due to its unique properties.
Uses
Used in Diagnostic Applications:
Gamma-glutamyl-2-naphthylamide is used as a substrate for the fluorimetric determination of aminopeptidases in the human brain. This application is significant because it aids in the study and understanding of aminopeptidase activity, which is crucial for various biological processes and can be indicative of certain neurological conditions.
Used in Pharmaceutical Research:
In the pharmaceutical industry, gamma-glutamyl-2-naphthylamide serves as a valuable compound for research purposes. Its unique structure allows scientists to study its interactions with various biological molecules, potentially leading to the development of new drugs and therapies.
Used in Analytical Chemistry:
Gamma-glutamyl-2-naphthylamide can be employed as a reagent in analytical chemistry for the detection and quantification of specific enzymes or other biomolecules. Its fluorescent properties make it an ideal candidate for assays and other laboratory tests.
Check Digit Verification of cas no
The CAS Registry Mumber 635-86-9 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,3 and 5 respectively; the second part has 2 digits, 8 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 635-86:
(5*6)+(4*3)+(3*5)+(2*8)+(1*6)=79
79 % 10 = 9
So 635-86-9 is a valid CAS Registry Number.
InChI:InChI=1/C15H16N2O3/c16-13(7-8-14(18)19)15(20)17-12-6-5-10-3-1-2-4-11(10)9-12/h1-6,9,13H,7-8,16H2,(H,17,20)(H,18,19)/t13-/m0/s1