637020-76-9 Usage
General Description
"(S)-ALPHA-(2-CHLOROBENZYL)-PROLINE-HCL" is a chemical compound that consists of an amino acid derivative and a hydrochloride salt. It contains a proline molecule that is attached to a (2-chlorobenzyl) group, and the stereochemistry of the proline is in the S configuration. (S)-ALPHA-(2-CHLOROBENZYL)-PROLINE-HCL is commonly used in pharmaceutical research as a building block for the synthesis of various drug molecules, due to its potential biological activity and therapeutic applications. Its properties and functions make it a valuable tool in medicinal chemistry for the development of new drugs and treatments.
Check Digit Verification of cas no
The CAS Registry Mumber 637020-76-9 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,3,7,0,2 and 0 respectively; the second part has 2 digits, 7 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 637020-76:
(8*6)+(7*3)+(6*7)+(5*0)+(4*2)+(3*0)+(2*7)+(1*6)=139
139 % 10 = 9
So 637020-76-9 is a valid CAS Registry Number.
InChI:InChI=1/C12H14ClNO2.ClH/c13-10-5-2-1-4-9(10)8-12(11(15)16)6-3-7-14-12;/h1-2,4-5,14H,3,6-8H2,(H,15,16);1H/t12-;/m0./s1