63775-95-1 Usage
Description
Cyclosporin B is a minor analogue of the cyclosporin complex, which is produced by various fungal genera such as Trichoderma, Tolypocladium, Fusarium, Nectria, and Acremonium. It is known for its immunosuppressant and antifungal properties, although it has not been as extensively studied as its major analogue, cyclosporin A.
Uses
Used in Organ Transplantation:
Cyclosporin B is used as an immunosuppressant in the medical field, particularly for revolutionizing organ transplantation. It plays a crucial role in the prevention of graft rejection, ensuring the success of transplant procedures.
Used in Pharmaceutical Applications:
Cyclosporin B is utilized as a group of nonpolar cyclic oligopeptides with immunosuppressant activity. This makes it a valuable compound for the development of new drugs and therapies in the pharmaceutical industry, targeting various immune-related conditions and diseases.
Check Digit Verification of cas no
The CAS Registry Mumber 63775-95-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,7,7 and 5 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 63775-95:
(7*6)+(6*3)+(5*7)+(4*7)+(3*5)+(2*9)+(1*5)=161
161 % 10 = 1
So 63775-95-1 is a valid CAS Registry Number.
InChI:InChI=1/C61H109N11O12/c1-25-26-27-39(14)51(74)50-55(78)64-41(16)56(79)66(18)32-47(73)67(19)43(28-33(2)3)54(77)65-48(37(10)11)60(83)68(20)44(29-34(4)5)53(76)62-40(15)52(75)63-42(17)57(80)69(21)45(30-35(6)7)58(81)70(22)46(31-36(8)9)59(82)71(23)49(38(12)13)61(84)72(50)24/h25-26,33-46,48-51,74H,27-32H2,1-24H3,(H,62,76)(H,63,75)(H,64,78)(H,65,77)/b26-25+/t39?,40-,41+,42+,43+,44+,45+,46+,48+,49+,50-,51?/m1/s1