63937-57-5 Usage
General Description
6,7-Dimethoxy-2-methyl-1-(4-nitrophenethyl)-1,2,3,4-tetrahydroisoquinoline is a complex chemical compound with a tetrahydroisoquinoline backbone and two methoxy groups, a methyl group, and a nitrophenethyl group attached. It is a derivative of isoquinoline and contains a nitrogen-containing heterocyclic ring structure. The compound is used in scientific research as a potential pharmacological agent due to its structural resemblance to other biologically active molecules. Its specific chemical and pharmacological properties are of interest for its potential use in medicinal chemistry and drug development.
Check Digit Verification of cas no
The CAS Registry Mumber 63937-57-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,9,3 and 7 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 63937-57:
(7*6)+(6*3)+(5*9)+(4*3)+(3*7)+(2*5)+(1*7)=155
155 % 10 = 5
So 63937-57-5 is a valid CAS Registry Number.
InChI:InChI=1/C20H24N2O4/c1-21-11-10-15-12-19(25-2)20(26-3)13-17(15)18(21)9-6-14-4-7-16(8-5-14)22(23)24/h4-5,7-8,12-13,18H,6,9-11H2,1-3H3