63990-57-8 Usage
Description
[2,4-Bis(1-methylbutyl)phenoxy]acetic acid chloride, commonly known as BMCPA chloride, is a synthetic organic compound characterized by its white crystalline solid appearance. It is soluble in organic solvents such as acetone and dichloromethane, and it serves as a crucial intermediate in the production of herbicides.
Uses
Used in Agricultural Industry:
BMCPA chloride is used as an intermediate in the synthesis of various herbicides for weed control. Its role is essential in the development of agricultural chemicals that help protect crops from unwanted plant growth, thereby increasing agricultural productivity and crop yield.
Used in Organic Chemistry Research:
Additionally, BMCPA chloride can be utilized as a research chemical in organic chemistry laboratories. It provides researchers with a valuable compound for studying the properties and reactions of chlorinated derivatives, contributing to the advancement of organic chemistry and the development of new chemical applications.
Check Digit Verification of cas no
The CAS Registry Mumber 63990-57-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,3,9,9 and 0 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 63990-57:
(7*6)+(6*3)+(5*9)+(4*9)+(3*0)+(2*5)+(1*7)=158
158 % 10 = 8
So 63990-57-8 is a valid CAS Registry Number.
InChI:InChI=1/C18H27ClO2/c1-5-7-13(3)15-9-10-17(21-12-18(19)20)16(11-15)14(4)8-6-2/h9-11,13-14H,5-8,12H2,1-4H3
63990-57-8Relevant articles and documents
5-LIPOXYGENASE INHIBITORS
-
, (2008/06/13)
This invention relates to 2-(substituted)-N-hydroxy-N-alkylcinnamamides of the formula: where R1 is C1 -C4 alkyl; n is 0 or 1; R2 is trifluoromethyl, C1 -C10 alkyl, phen(C1 -C4)alkylene or where m is 0, 1 or 2 and R3 is C1 -C4 alkyl; X is C1 -C6 alkyl, ph
