64051-29-2 Usage
General Description
Dioleyl phosphonate is a chemical compound consisting of a phosphonate group attached to two oleyl (or octadecenyl) groups. It is commonly used as an emulsifier and stabilizer in various industrial and consumer products, such as paints, coatings, and personal care products. It acts as a dispersant, improving the compatibility of different ingredients in a formulation, and also helps to maintain the stability and consistency of products. Additionally, dioleyl phosphonate can function as a corrosion inhibitor, particularly in metalworking fluids and lubricants, where it helps to protect metal surfaces from degradation caused by exposure to water and other corrosive agents. Overall, dioleyl phosphonate plays a crucial role in the formulation and performance of a wide range of products, contributing to their stability, functionality, and longevity.
Check Digit Verification of cas no
The CAS Registry Mumber 64051-29-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,0,5 and 1 respectively; the second part has 2 digits, 2 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 64051-29:
(7*6)+(6*4)+(5*0)+(4*5)+(3*1)+(2*2)+(1*9)=102
102 % 10 = 2
So 64051-29-2 is a valid CAS Registry Number.
InChI:InChI=1/C36H70O3P/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-40(37)39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2/h17-20H,3-16,21-36H2,1-2H3/q+1/b19-17+,20-18+