64111-89-3 Usage
General Description
Dipropylene glycol dimethacrylate is a chemical compound that is commonly used in the production of adhesives, coatings, and sealants. It is a viscous liquid with a low volatility and a high refractive index, making it a versatile ingredient in various industrial applications. Dipropylene glycol dimethacrylate is known for its excellent adhesion, durability, and resistance to chemicals, making it a popular choice for bonding and sealing operations. It is also used as a cross-linking agent in the production of polymers and resins, providing enhanced mechanical properties and thermal stability in the final products. Additionally, dipropylene glycol dimethacrylate is considered to have low acute toxicity and minimal environmental impact, further adding to its appeal in various manufacturing processes.
Check Digit Verification of cas no
The CAS Registry Mumber 64111-89-3 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,1,1 and 1 respectively; the second part has 2 digits, 8 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 64111-89:
(7*6)+(6*4)+(5*1)+(4*1)+(3*1)+(2*8)+(1*9)=103
103 % 10 = 3
So 64111-89-3 is a valid CAS Registry Number.
InChI:InChI=1/C10H14O4.2C3H6/c1-7(2)9(11)13-5-6-14-10(12)8(3)4;2*1-3-2/h1,3,5-6H2,2,4H3;2*3H,1H2,2H3
