64437-72-5 Usage
Description
N-[[(aminocarbonyl)amino]methyl]acrylamide, also known as PAMAMAM, is a versatile chemical compound with a molecular structure that features an acrylamide group modified with an amino carbonyl functional group. It is widely recognized for its role as a monomer in the synthesis of polymer materials, particularly in the creation of dendrimers and polyamidoamine (PAMAM) dendrimers. PAMAMAM's unique properties allow it to form stable and biocompatible complexes with various molecules, making it a valuable reagent for chemical modifications and a promising candidate for applications in materials science and biochemistry.
Uses
Used in Polymer Synthesis:
N-[[(aminocarbonyl)amino]methyl]acrylamide is used as a monomer for the synthesis of polymer materials, particularly in the production of dendrimers and PAMAM dendrimers. Its ability to form stable and biocompatible complexes with various molecules makes it an essential component in the development of advanced polymer materials.
Used in Drug Delivery Systems:
In the pharmaceutical industry, N-[[(aminocarbonyl)amino]methyl]acrylamide is utilized in the development of drug delivery systems. Its capacity to form stable complexes with drug molecules allows for the creation of systems that can effectively transport and release therapeutic agents, improving the efficacy and safety of treatments.
Used as a Reagent for Chemical Modifications:
N-[[(aminocarbonyl)amino]methyl]acrylamide also serves as a reagent for chemical modifications in various fields of research and development. Its versatility in forming stable complexes with different molecules makes it a valuable tool for modifying the properties of other compounds and enhancing their performance in various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 64437-72-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,4,3 and 7 respectively; the second part has 2 digits, 7 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 64437-72:
(7*6)+(6*4)+(5*4)+(4*3)+(3*7)+(2*7)+(1*2)=135
135 % 10 = 5
So 64437-72-5 is a valid CAS Registry Number.
InChI:InChI=1/C5H9N3O2/c1-2-4(9)7-3-8-5(6)10/h2H,1,3H2,(H,7,9)(H3,6,8,10)
64437-72-5Relevant articles and documents
Addition d'une double liaison sur les polycondensats uree formol. Etude cinetique de la formation de l'acrylamido methylene uree
Lalo, Jack,Garrigue, Roger,Daydou, Francis
, p. 474 - 477 (2007/10/02)
The addition of acrylamido methylene urea during synthesis of urea formaldehyde resins leads to double bonded polycondensates.The condensation reaction involving urea and N-methylol acrylamide follows the pathway of specific acid catalysis.Usual synthesis conditions of urea formaldehyde resins do not allow the formation of a double bond.Indeed, the determination of rate constants shows that the formation rate of methylene linkage between urea and N-methylolacrylamide is slower than the formation rate of methylene linkage between urea and N-methylolurea.
