64497-95-6 Usage
Type of compound
Substituted pyridine derivative
Structural features
Contains a benzyl group
Contains a methyl group attached to the pyridine ring
Common uses
Building block for the synthesis of various pharmaceutical drugs and organic compounds
Versatile precursor for the development of new drugs and potentially biologically active molecules
Reagent in organic synthesis and chemical research
Industries
Pharmaceutical and research industries
Potential applications
Wide range of potential applications in the field of medicinal and organic chemistry
Check Digit Verification of cas no
The CAS Registry Mumber 64497-95-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,4,9 and 7 respectively; the second part has 2 digits, 9 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 64497-95:
(7*6)+(6*4)+(5*4)+(4*9)+(3*7)+(2*9)+(1*5)=166
166 % 10 = 6
So 64497-95-6 is a valid CAS Registry Number.
InChI:InChI=1/C15H17NO/c1-12-8-15(13(2)17)11-16(9-12)10-14-6-4-3-5-7-14/h3-7,9,11H,8,10H2,1-2H3