64704-41-2 Usage
General Description
GRANULIBERIN R is a chemical compound primarily used as a granulating agent in pharmaceutical formulations. It acts as a binder and disintegrant, helping to form granules and improve the flowability of powders during tablet manufacturing. The primary ingredient in GRANULIBERIN R is starch, which also contributes to its binding and disintegrating properties. Additionally, it is a non-toxic and biodegradable substance, making it suitable for use in pharmaceutical preparations. Overall, GRANULIBERIN R plays a crucial role in the production of high-quality pharmaceutical tablets by improving their manufacturability and performance.
Check Digit Verification of cas no
The CAS Registry Mumber 64704-41-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,4,7,0 and 4 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 64704-41:
(7*6)+(6*4)+(5*7)+(4*0)+(3*4)+(2*4)+(1*1)=122
122 % 10 = 2
So 64704-41-2 is a valid CAS Registry Number.
InChI:InChI=1/C69H103N19O14/c1-6-40(4)56(86-64(99)54-24-16-32-88(54)67(102)51(33-39(2)3)84-61(96)49(35-43-19-11-8-12-20-43)80-55(91)37-78-59(94)46(70)34-42-17-9-7-10-18-42)65(100)83-50(36-44-25-27-45(90)28-26-44)62(97)81-47(21-13-29-76-68(72)73)60(95)82-48(22-14-30-77-69(74)75)66(101)87-31-15-23-53(87)63(98)79-41(5)58(93)85-52(38-89)57(71)92/h7-12,17-20,25-28,39-41,46-54,56,89-90H,6,13-16,21-24,29-38,70H2,1-5H3,(H2,71,92)(H,78,94)(H,79,98)(H,80,91)(H,81,97)(H,82,95)(H,83,100)(H,84,96)(H,85,93)(H,86,99)(H4,72,73,76)(H4,74,75,77)