651-97-8 Usage
Description
3,6-Difluorophthalic acid is a fluorinated analog of phthalic acid, which is an organic compound with the molecular formula C8H4F2O4. It features two fluorine atoms replacing two hydrogen atoms in the phthalic acid structure, providing unique properties and potential applications in various industries.
Uses
Used in Chemical Synthesis:
3,6-Difluorophthalic acid is used as a key intermediate in the chemical synthesis of various compounds, particularly in the production of fluorinated derivatives of phthalic acid and related chemicals. The presence of fluorine atoms in the molecule can significantly alter the reactivity, stability, and physical properties of the resulting compounds, making them suitable for specific applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 3,6-difluorophthalic acid can be used as a building block for the development of novel drugs with improved pharmacological properties. The introduction of fluorine atoms can enhance the lipophilicity, metabolic stability, and bioavailability of the drug candidates, leading to better therapeutic outcomes.
Used in Material Science:
3,6-Difluorophthalic acid can be utilized in the development of advanced materials with specific properties, such as high thermal stability, chemical resistance, and low refractive index. These materials can find applications in various fields, including electronics, aerospace, and automotive industries.
Used in Dye and Pigment Industry:
The unique properties of 3,6-difluorophthalic acid can be exploited in the synthesis of novel dyes and pigments with enhanced color strength, lightfastness, and stability. These fluorinated dyes and pigments can be used in various applications, such as inks, coatings, and plastics, to provide improved performance and durability.
Used in Agrochemical Industry:
3,6-Difluorophthalic acid can be employed in the development of new agrochemicals, such as herbicides, insecticides, and fungicides, with enhanced efficacy and selectivity. The introduction of fluorine atoms can improve the penetration, mobility, and target site binding of these agrochemicals, leading to better control of pests and diseases in agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 651-97-8 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,5 and 1 respectively; the second part has 2 digits, 9 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 651-97:
(5*6)+(4*5)+(3*1)+(2*9)+(1*7)=78
78 % 10 = 8
So 651-97-8 is a valid CAS Registry Number.
InChI:InChI=1/C8H4F2O4/c9-3-1-2-4(10)6(8(13)14)5(3)7(11)12/h1-2H,(H,11,12)(H,13,14)
651-97-8Relevant articles and documents
The Synthesis of 1,4-Difluoro-5,8-dihydroxyanthracene-9,10-dione and Ipso Substitutions of the Fluorides by Diamines Leading to 1,4-Bis--5,8-dihydroxyanthracene-9,10-diones
Krapcho, A. Paul,Getahun, Zelleka,Avery, Kenneth J.
, p. 2139 - 2146 (2007/10/02)
Two synthetic pathways to 1,4-difluoro-5,8-dihydroxyanthracene-9,10-dione (2) are described.The ipso substitution of the fluorides of 2 by diamines is a valuable preparative route to 1,4-bis-5,8-dihydroxyanthracene-9,10-diones related t
