65208-41-5 Usage
Description
CALCIUM THIOGLYCOLATE TRIHYDRATE, also known as Mercaptoacetic acid calcium salt trihydrate, is a chemical compound with the formula Ca(SC2H4COO)2·3H2O. It is a white crystalline solid that is soluble in water and has a slightly acidic pH. CALCIUM THIOGLYCOLATE TRIHYDRATE is known for its reducing properties and is commonly used in various industries due to its unique characteristics.
Uses
Used in Cosmetic Applications:
CALCIUM THIOGLYCOLATE TRIHYDRATE is used as a reducing agent for hair perms, straighteners, and depilatory formulations. It helps to break the disulfide bonds in hair proteins, allowing for the restructuring of hair and providing the desired curl or straightening effect. Additionally, its reducing properties make it suitable for use in depilatory products, which help to remove hair from the skin.
Used in Pharmaceutical Industry:
CALCIUM THIOGLYCOLATE TRIHYDRATE is used as an active pharmaceutical ingredient for the treatment of heavy metal poisoning. Its chelating properties enable it to bind with heavy metal ions, such as lead, mercury, and arsenic, and facilitate their removal from the body, thus providing a therapeutic effect in cases of heavy metal intoxication.
Used in Analytical Chemistry:
CALCIUM THIOGLYCOLATE TRIHYDRATE is used as a reagent in analytical chemistry for the detection and quantification of various metal ions. Its ability to form complexes with metal ions makes it a valuable tool in the identification and measurement of metal concentrations in samples.
Used in Environmental Applications:
CALCIUM THIOGLYCOLATE TRIHYDRATE is used as a remediation agent for the treatment of contaminated soil and water. Its chelating properties allow it to bind with heavy metal pollutants, facilitating their removal and reducing the environmental impact of these toxic substances.
Check Digit Verification of cas no
The CAS Registry Mumber 65208-41-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,5,2,0 and 8 respectively; the second part has 2 digits, 4 and 1 respectively.
Calculate Digit Verification of CAS Registry Number 65208-41:
(7*6)+(6*5)+(5*2)+(4*0)+(3*8)+(2*4)+(1*1)=115
115 % 10 = 5
So 65208-41-5 is a valid CAS Registry Number.
InChI:InChI=1/C2H4O2S.Ca.3H2O/c3-1-2(4)5;;;;/h3H,1H2,(H,4,5);;3*1H2/q;+2;;;/p-1
