6525-46-8 Usage
Description
5-NITRO-DL-TRYPTOPHAN is a synthetic nitro derivative of the essential amino acid tryptophan, which is not naturally occurring. The presence of the nitro group on the tryptophan molecule endows it with distinct properties and potential applications compared to the unmodified amino acid. 5-NITRO-DL-TRYPTOPHAN is primarily utilized in research and chemical synthesis, with studies exploring its potential pharmaceutical applications, such as in the development of antibiotics and anti-tumor agents. Furthermore, 5-NITRO-DL-TRYPTOPHAN holds promise in the field of neuroscience due to its capacity to influence neurotransmitter levels in the brain.
Uses
Used in Pharmaceutical Research and Development:
5-NITRO-DL-TRYPTOPHAN is used as a key intermediate in the synthesis of various pharmaceutical compounds for the development of antibiotics and anti-tumor agents. Its unique properties allow for the creation of novel drug candidates with potential therapeutic benefits.
Used in Neuroscience Research:
In the field of neuroscience, 5-NITRO-DL-TRYPTOPHAN is utilized as a research tool to study its effects on neurotransmitter levels in the brain. This can contribute to a better understanding of neurological disorders and the development of new treatments for such conditions.
Used in Chemical Synthesis:
5-NITRO-DL-TRYPTOPHAN serves as a building block in the synthesis of complex organic compounds, which can be applied in various chemical and industrial processes. Its unique structure makes it a valuable component in the creation of new chemical entities with diverse applications.
Check Digit Verification of cas no
The CAS Registry Mumber 6525-46-8 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,5,2 and 5 respectively; the second part has 2 digits, 4 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 6525-46:
(6*6)+(5*5)+(4*2)+(3*5)+(2*4)+(1*6)=98
98 % 10 = 8
So 6525-46-8 is a valid CAS Registry Number.
InChI:InChI=1/C11H11N3O4/c12-9(11(15)16)3-6-5-13-10-2-1-7(14(17)18)4-8(6)10/h1-2,4-5,9,13H,3,12H2,(H,15,16)
6525-46-8Relevant articles and documents
Syntheses of Substituted L- and D-Tryptophans
Irie, Kunihiko,Ishida, Akihiko,Nakamura, Tohru,Oh-ishi, Tokuro
, p. 2126 - 2139 (2007/10/02)
Several 5-substituted nb-methoxycarbonyl-L- and -D-tryptophan derivatives were synthesized from proline by a new route involving electrochemical oxidation, as well as by the known procedures.Removal of the Nb-methoxycarbonyl group was accomplished by treatment with Me3SiI in refluxing chloroform, then alkaline hydrolysis of the methyl esters afforded 5-substituted L- and D-tryptophans with high optical purities.Keywords - L-tryptophan 5-substituted; D-tryptophan 5-substituted; anodic oxidation; N-methoxycarbonyl group deprotection; Fischer indole synthesis; iodotrimethylsilane
