6531-42-6 Usage
Description
Butanoic acid, 2-amino-3-oxo(9CI) is an alpha-amino acid that is acetoacetic acid substituted by an amino group at position 2. It is a derivative of butyric acid with an additional amino group, which gives it unique chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
Butanoic acid, 2-amino-3-oxo(9CI) is used as an intermediate in the synthesis of various pharmaceutical compounds. Its unique structure allows it to be a key component in the development of new drugs with potential therapeutic applications.
Used in Chemical Synthesis:
Butanoic acid, 2-amino-3-oxo(9CI) is used as a building block in the synthesis of various organic compounds. Its versatile structure makes it a valuable precursor for the production of specialty chemicals, agrochemicals, and other industrial products.
Used in Research and Development:
Butanoic acid, 2-amino-3-oxo(9CI) is used as a research compound in the study of amino acid chemistry, protein synthesis, and other biological processes. Its unique properties make it an interesting subject for scientific investigation and potential applications in biotechnology and medicine.
Check Digit Verification of cas no
The CAS Registry Mumber 6531-42-6 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,5,3 and 1 respectively; the second part has 2 digits, 4 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 6531-42:
(6*6)+(5*5)+(4*3)+(3*1)+(2*4)+(1*2)=86
86 % 10 = 6
So 6531-42-6 is a valid CAS Registry Number.
InChI:InChI=1/C4H7NO3/c1-2(6)3(5)4(7)8/h3H,5H2,1H3,(H,7,8)
