657410-79-2 Usage
Description
1-METHYL-4-(6-NITROPYRIDIN-3-YL)PIPERAZINE is an organic compound with the molecular formula C9H12N6O2. It is a heterocyclic compound featuring a piperazine ring fused with a nitropyridine moiety. 1-METHYL-4-(6-NITROPYRIDIN-3-YL)PIPERAZINE is known for its potential applications in the pharmaceutical industry due to its unique chemical structure and properties.
Uses
Used in Pharmaceutical Industry:
1-METHYL-4-(6-NITROPYRIDIN-3-YL)PIPERAZINE is used as a chemical intermediate for the synthesis of pyrazolyl-pyrimidines, which are selective inhibitors of CDK4/CDK6. These inhibitors play a crucial role in regulating cell cycle progression and have potential applications in the treatment of various types of cancer, as they can help prevent uncontrolled cell growth and division.
1-METHYL-4-(6-NITROPYRIDIN-3-YL)PIPERAZINE's ability to inhibit CDK4/CDK6 makes it a valuable asset in the development of targeted cancer therapies, as it can potentially be used to design and synthesize new drugs that specifically target these proteins, leading to more effective treatments with fewer side effects.
Check Digit Verification of cas no
The CAS Registry Mumber 657410-79-2 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,5,7,4,1 and 0 respectively; the second part has 2 digits, 7 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 657410-79:
(8*6)+(7*5)+(6*7)+(5*4)+(4*1)+(3*0)+(2*7)+(1*9)=172
172 % 10 = 2
So 657410-79-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H14N4O2/c1-12-4-6-13(7-5-12)9-2-3-10(11-8-9)14(15)16/h2-3,8H,4-7H2,1H3
