658-93-5 Usage
Description
3,4-Difluorophenylacetic acid is an organic compound that consists of a phenylacetic acid structure with two fluorine atoms substituted at the 3rd and 4th positions on the phenyl ring. 3,4-Difluorophenylacetic acid has been studied for its separation and analysis through various chromatographic and electrophoretic techniques, including normaland reversed-phase HPLC, capillary zone electrophoresis, gas chromatography, and supercritical fluid chromatography.
Uses
Used in Pharmaceutical Industry:
3,4-Difluorophenylacetic acid is used as a building block for the synthesis of various pharmaceutical compounds. Its unique structure with fluorine substitutions can impart specific properties to the resulting molecules, making them more potent or selective in their biological activity.
Used in Chemical Research:
In the field of chemical research, 3,4-difluorophenylacetic acid serves as a valuable compound for studying the effects of fluorine substitution on the properties and reactivity of phenylacetic acid derivatives. This can lead to a better understanding of structure-activity relationships and the development of new synthetic strategies.
Used in Analytical Chemistry:
3,4-Difluorophenylacetic acid is used as a reference compound in the development and optimization of analytical methods for the separation and detection of positional isomers. Its analysis through various chromatographic and electrophoretic techniques helps in refining the methods for the accurate identification and quantification of similar compounds in complex mixtures.
Used in Material Science:
The unique properties of 3,4-difluorophenylacetic acid, such as its fluorine substitutions, can be exploited in the development of new materials with specific characteristics, such as improved thermal stability, chemical resistance, or optical properties. These materials can find applications in various industries, including electronics, coatings, and plastics.
Check Digit Verification of cas no
The CAS Registry Mumber 658-93-5 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,5 and 8 respectively; the second part has 2 digits, 9 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 658-93:
(5*6)+(4*5)+(3*8)+(2*9)+(1*3)=95
95 % 10 = 5
So 658-93-5 is a valid CAS Registry Number.
InChI:InChI=1/C8H6F2O2/c9-6-2-1-5(3-7(6)10)4-8(11)12/h1-3H,4H2,(H,11,12)
