659731-18-7 Usage
General Description
(3-Pyrrolidin-1-ylphenyl)boronic acid is a chemical compound that belongs to the class of boronic acids, which are widely used in organic synthesis and pharmaceutical research. It consists of a boronic acid group attached to a phenyl ring with a pyrrolidine substituent. (3-Pyrrolidin-1-ylphenyl)boronic acid has potential applications in the development of new drugs, as boronic acids are known for their ability to interact with biological targets and as potential enzyme inhibitors. Additionally, it can be used in the synthesis of complex organic molecules and as a reagent in chemical reactions, making it a valuable tool for chemists and researchers in the field of medicinal chemistry and drug discovery.
Check Digit Verification of cas no
The CAS Registry Mumber 659731-18-7 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,5,9,7,3 and 1 respectively; the second part has 2 digits, 1 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 659731-18:
(8*6)+(7*5)+(6*9)+(5*7)+(4*3)+(3*1)+(2*1)+(1*8)=197
197 % 10 = 7
So 659731-18-7 is a valid CAS Registry Number.
InChI:InChI=1/C10H14BNO2/c13-11(14)9-4-3-5-10(8-9)12-6-1-2-7-12/h3-5,8,13-14H,1-2,6-7H2
