6615-00-5 Usage
Description
11a-Hydroxy-estr-4-ene-3,17-dione is a synthetic steroid hormone derivative that serves as an intermediate in the synthesis of various pharmaceutical compounds. It possesses a unique chemical structure that allows it to be used in the development of medications with specific therapeutic applications.
Uses
Used in Pharmaceutical Industry:
11a-Hydroxy-estr-4-ene-3,17-dione is used as an intermediate in the synthesis of 18-demethyl Etonogestrel, which is the active metabolite of Desogestrel. This intermediate plays a crucial role in the development of contraceptive medications, as well as other hormone-related therapies.
Flammability and Explosibility
Nonflammable
Check Digit Verification of cas no
The CAS Registry Mumber 6615-00-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,1 and 5 respectively; the second part has 2 digits, 0 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 6615-00:
(6*6)+(5*6)+(4*1)+(3*5)+(2*0)+(1*0)=85
85 % 10 = 5
So 6615-00-5 is a valid CAS Registry Number.
InChI:InChI=1/C18H24O3/c1-18-9-15(20)17-12-5-3-11(19)8-10(12)2-4-13(17)14(18)6-7-16(18)21/h8,12-15,17,20H,2-7,9H2,1H3/t12-,13-,14-,15+,17+,18-/m0/s1