66262-68-8 Usage
Description
Monic acid A is the primary metabolite of the antibiotic Mupirocin, which is derived from the Pseudomonas fluorescens bacteria. It possesses unique chemical properties and is utilized in various applications across different industries.
Uses
Used in Pharmaceutical Industry:
Monic acid A is used as an antibiotic metabolite for its antimicrobial properties, playing a crucial role in the development of Mupirocin, a widely used antibiotic.
Used in Agriculture:
Monic acid A is used as a cereal herbicide for its ability to control the growth of unwanted plants, ensuring the healthy development of cereal crops.
Used in Veterinary Medicine:
Monic acid A is used as a mycoplasma inhibitor for its effectiveness in preventing the growth of mycoplasma bacteria, which can cause various diseases in animals.
Check Digit Verification of cas no
The CAS Registry Mumber 66262-68-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,2,6 and 2 respectively; the second part has 2 digits, 6 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 66262-68:
(7*6)+(6*6)+(5*2)+(4*6)+(3*2)+(2*6)+(1*8)=138
138 % 10 = 8
So 66262-68-8 is a valid CAS Registry Number.
InChI:InChI=1/C17H28O7/c1-8(5-14(19)20)4-12-16(22)15(21)11(7-23-12)6-13-17(24-13)9(2)10(3)18/h5,9-13,15-18,21-22H,4,6-7H2,1-3H3,(H,19,20)/b8-5+/t9-,10?,11+,12-,13?,15-,16+,17?/m0/s1