6641-84-5 Usage
General Description
12-hydroxy-octadecanoic acid-(2-methoxy-ethyl ester) is a chemical compound composed of a long chain hydrocarbon with a hydroxyl group and a methoxy group attached to the carbon backbone. 12-hydroxy-octadecanoic acid-(2-methoxy-ethyl ester) is classified as an ester, with the hydroxyl group and the carboxylic acid group reacting to form a molecule with a carbonyl functional group and an ethoxy group. It is commonly used in the production of various industrial products such as surfactants, lubricants, and cosmetics due to its emulsifying and moisturizing properties. Additionally, it also has potential applications in the pharmaceutical industry as a precursor for the synthesis of bioactive compounds. However, the exact properties and potential uses of this compound may vary depending on its specific chemical structure and purity.
Check Digit Verification of cas no
The CAS Registry Mumber 6641-84-5 includes 7 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 4 digits, 6,6,4 and 1 respectively; the second part has 2 digits, 8 and 4 respectively.
Calculate Digit Verification of CAS Registry Number 6641-84:
(6*6)+(5*6)+(4*4)+(3*1)+(2*8)+(1*4)=105
105 % 10 = 5
So 6641-84-5 is a valid CAS Registry Number.
InChI:InChI=1/C21H42O4/c1-3-4-5-12-15-20(22)16-13-10-8-6-7-9-11-14-17-21(23)25-19-18-24-2/h20,22H,3-19H2,1-2H3
