66756-57-8 Usage
Description
(2S)-2β-(3-Furyl)-4aα,5,6aβ,7,10,11,11aα,11b-octahydro-11bβ-methyl-7β,10β-methano-2H-pyrano[4,3-g][3]benzoxepine-4,6,8(1H)-trione is a complex organic compound with a unique molecular structure. It is characterized by its furan and benzoxepine rings, which contribute to its potential biological activities and applications.
Uses
Used in Pharmaceutical Industry:
(2S)-2β-(3-Furyl)-4aα,5,6aβ,7,10,11,11aα,11b-octahydro-11bβ-methyl-7β,10β-methano-2H-pyrano[4,3-g][3]benzoxepine-4,6,8(1H)-trione is used as a potential therapeutic agent for various diseases due to its cytotoxic and anti-inflammatory properties. Its unique structure allows it to interact with specific biological targets, making it a promising candidate for drug development.
Used in Cancer Research:
In cancer research, (2S)-2β-(3-Furyl)-4aα,5,6aβ,7,10,11,11aα,11b-octahydro-11bβ-methyl-7β,10β-methano-2H-pyrano[4,3-g][3]benzoxepine-4,6,8(1H)-trione has shown to induce cytotoxicity against human hepatocellular carcinoma cells and apoptosis in normal human liver L-02 cells. This suggests its potential use as an anticancer agent, particularly in the treatment of liver cancer.
Used in Anti-Inflammatory Applications:
(2S)-2β-(3-Furyl)-4aα,5,6aβ,7,10,11,11aα,11b-octahydro-11bβ-methyl-7β,10β-methano-2H-pyrano[4,3-g][3]benzoxepine-4,6,8(1H)-trione also exhibits anti-inflammatory properties, making it a candidate for the development of new anti-inflammatory drugs. This could be particularly useful in treating conditions such as arthritis, where inflammation plays a significant role in the disease progression.
Check Digit Verification of cas no
The CAS Registry Mumber 66756-57-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,6,7,5 and 6 respectively; the second part has 2 digits, 5 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 66756-57:
(7*6)+(6*6)+(5*7)+(4*5)+(3*6)+(2*5)+(1*7)=168
168 % 10 = 8
So 66756-57-8 is a valid CAS Registry Number.
InChI:InChI=1/C19H20O6/c1-19-7-15(9-2-3-23-8-9)25-18(22)13(19)6-14(20)16-11-4-10(5-12(16)19)24-17(11)21/h2-3,8,10-13,15-16H,4-7H2,1H3