671-30-7 Usage
Description
2-Fluoro-3-hydroxypropanoic acid methyl ester, also known as Methyl 2-Fluoro-3-hydroxypropanoate, is an organic compound that features a fluorinated hydroxypropanoic acid structure with a methyl ester group. It is characterized by the presence of a fluorine atom at the second carbon and a hydroxyl group at the third carbon, which is esterified with a methyl group. This unique molecular structure endows it with specific chemical properties and potential applications in various fields.
Uses
Used in Pharmaceutical Industry:
2-Fluoro-3-hydroxypropanoic acid methyl ester is used as a key intermediate in the synthesis of cyclopeptide containing heteroaryl compounds for the treatment of cancers. Its unique structure allows for the development of novel therapeutic agents that can target and inhibit specific cancer-related pathways, offering new treatment options for patients with various types of cancer.
In the preparation of these cyclopeptides, 2-Fluoro-3-hydroxypropanoic acid methyl ester plays a crucial role in the formation of the peptide backbone and the incorporation of heteroaryl moieties, which are essential for the biological activity of the final product. The use of this compound in the pharmaceutical industry highlights its potential as a valuable building block for the development of innovative cancer therapies.
Check Digit Verification of cas no
The CAS Registry Mumber 671-30-7 includes 6 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 3 digits, 6,7 and 1 respectively; the second part has 2 digits, 3 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 671-30:
(5*6)+(4*7)+(3*1)+(2*3)+(1*0)=67
67 % 10 = 7
So 671-30-7 is a valid CAS Registry Number.
InChI:InChI=1/C4H7FO3/c1-8-4(7)3(5)2-6/h3,6H,2H2,1H3
