67650-35-5 Usage
Description
1,6-Anhydro-4-O-(2,3,4,6-tetra-O-acetyl-α-D-mannopyranosyl)-β-D-mannopyranose is a complex carbohydrate derivative with a unique structure and properties. It is a key intermediate in the synthesis of various complex carbohydrates and glycoconjugates, which have potential applications in various fields.
Uses
Used in Carbohydrate Synthesis:
1,6-Anhydro-4-O-(2,3,4,6-tetra-O-acetyl-α-D-mannopyranosyl)-β-D-mannopyranose is used as a key intermediate in the synthesis of 4-O-α-D-mannopyranosyl-D-mannopyranose and its benzyl 1-thio-α-D-glycoside. These synthesized compounds have potential applications in various fields, such as pharmaceuticals, diagnostics, and materials science.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 1,6-Anhydro-4-O-(2,3,4,6-tetra-O-acetyl-α-D-mannopyranosyl)-β-D-mannopyranose is used as a building block for the synthesis of complex carbohydrates and glycoconjugates, which can be used as drug candidates or drug delivery systems. These synthesized compounds can target specific receptors or pathways, leading to improved therapeutic outcomes.
Used in Diagnostics:
1,6-Anhydro-4-O-(2,3,4,6-tetra-O-acetyl-α-D-mannopyranosyl)-β-D-mannopyranose can be used in the development of diagnostic tools, such as glycan arrays or biosensors, for the detection and analysis of various diseases. The unique structure and properties of this compound allow for specific interactions with biological molecules, enabling the detection of disease markers or biomarkers.
Used in Materials Science:
In materials science, 1,6-Anhydro-4-O-(2,3,4,6-tetra-O-acetyl-α-D-mannopyranosyl)-β-D-mannopyranose can be used in the development of advanced materials with unique properties, such as self-assembling systems, hydrogels, or surface coatings. The ability of this compound to form specific interactions with other molecules can lead to the creation of materials with improved properties, such as biocompatibility, stability, or responsiveness to environmental stimuli.
Check Digit Verification of cas no
The CAS Registry Mumber 67650-35-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,7,6,5 and 0 respectively; the second part has 2 digits, 3 and 5 respectively.
Calculate Digit Verification of CAS Registry Number 67650-35:
(7*6)+(6*7)+(5*6)+(4*5)+(3*0)+(2*3)+(1*5)=145
145 % 10 = 5
So 67650-35-5 is a valid CAS Registry Number.
InChI:InChI=1/C20H28O14/c1-7(21)27-5-12-16(29-8(2)22)17(30-9(3)23)18(31-10(4)24)20(33-12)34-15-11-6-28-19(32-11)14(26)13(15)25/h11-20,25-26H,5-6H2,1-4H3