68003-28-1 Usage
General Description
The chemical "7,8,9,10,11,12,20,21,22,23,24,25-dodecahydrodibenzo[i,t][1,4,7,12,15,18]hexaazacyclodocosine-5,13,18,26(6H,19H)-tetrone" is an organic compound with a complex molecular structure. It is a tetracyclic compound containing a combination of nitrogen and carbon atoms arranged in a unique ring system. Its chemical formula suggests that it contains twelve hydrogen atoms and twenty-six oxygen atoms. The compound's unique structure and arrangement of atoms make it important in the field of organic chemistry and potentially provide interesting properties and potential applications.
Check Digit Verification of cas no
The CAS Registry Mumber 68003-28-1 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,0,0 and 3 respectively; the second part has 2 digits, 2 and 8 respectively.
Calculate Digit Verification of CAS Registry Number 68003-28:
(7*6)+(6*8)+(5*0)+(4*0)+(3*3)+(2*2)+(1*8)=111
111 % 10 = 1
So 68003-28-1 is a valid CAS Registry Number.
InChI:InChI=1/C24H30N6O4/c31-21-17-5-1-2-6-18(17)22(32)28-14-10-26-12-16-30-24(34)20-8-4-3-7-19(20)23(33)29-15-11-25-9-13-27-21/h1-8,25-26H,9-16H2,(H,27,31)(H,28,32)(H,29,33)(H,30,34)