68156-13-8 Usage
General Description
Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate is a chemical compound with a complex structure consisting of diphenyl(4-phenylthio)phenylsufonium cation and hexafluorophosphate anion. It is widely used as a photoinitiator in the synthesis of polymers and photoresists. Diphenyl(4-phenylthio)phenylsufonium hexafluorophosphate is often employed in photopolymerization processes, where it absorbs light and initiates the chemical reaction that leads to the formation of the polymer. Its unique structure and reactivity make it a valuable tool in the development of advanced materials with specific properties and applications in various industries, including electronics, coatings, and biomedical fields. However, due to its complex nature and potential reactivity, careful handling and storage are necessary to ensure safety and proper usage of this chemical.
Check Digit Verification of cas no
The CAS Registry Mumber 68156-13-8 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,1,5 and 6 respectively; the second part has 2 digits, 1 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 68156-13:
(7*6)+(6*8)+(5*1)+(4*5)+(3*6)+(2*1)+(1*3)=138
138 % 10 = 8
So 68156-13-8 is a valid CAS Registry Number.
InChI:InChI=1/C24H19S2.F6P/c1-4-12-20(13-5-1)25-23-18-10-11-19-24(23)26(21-14-6-2-7-15-21)22-16-8-3-9-17-22;1-7(2,3,4,5)6/h1-19H;/q+1;-1