68162-50-5 Usage
General Description
2-Hydroxyethyl gallate (2-HEG) is a chemical compound that belongs to the class of gallate antioxidants. It is derived from gallic acid and is commonly used in pharmaceuticals, cosmetics, and food products due to its strong antioxidant properties. 2-HEG has been shown to effectively scavenge free radicals, reduce oxidative stress, and protect cells from damage. It also exhibits anti-inflammatory and anti-carcinogenic activities, making it a potential candidate for various therapeutic applications. Additionally, 2-HEG has been found to have antimicrobial properties, further adding to its potential usefulness in various industries. Overall, 2-hydroxyethyl gallate is a versatile compound with a wide range of potential applications due to its antioxidant, anti-inflammatory, anti-carcinogenic, and antimicrobial properties.
Check Digit Verification of cas no
The CAS Registry Mumber 68162-50-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,1,6 and 2 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 68162-50:
(7*6)+(6*8)+(5*1)+(4*6)+(3*2)+(2*5)+(1*0)=135
135 % 10 = 5
So 68162-50-5 is a valid CAS Registry Number.
InChI:InChI=1/C9H10O6/c10-1-2-15-9(14)5-3-6(11)8(13)7(12)4-5/h3-4,10-13H,1-2H2
