68239-06-5 Usage
General Description
The chemical 2-heptyl-3,4-bis(9-isocyanatononyl)-1-pentylcyclohexane is a complex organic compound with a molecular structure containing heptyl, isocyanatononyl, and pentyl groups attached to a cyclohexane ring. It is commonly used as a raw material for the production of polyurethane foam, coatings, adhesives, and sealants. This chemical is known for its high thermal stability, which makes it suitable for applications requiring resistance to high temperatures. Additionally, it is also used in the manufacture of industrial products such as insulation materials, automotive parts, and building materials. However, its usage requires careful handling and proper safety precautions due to its potential hazards.
Check Digit Verification of cas no
The CAS Registry Mumber 68239-06-5 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,2,3 and 9 respectively; the second part has 2 digits, 0 and 6 respectively.
Calculate Digit Verification of CAS Registry Number 68239-06:
(7*6)+(6*8)+(5*2)+(4*3)+(3*9)+(2*0)+(1*6)=145
145 % 10 = 5
So 68239-06-5 is a valid CAS Registry Number.
InChI:InChI=1/C38H70N2O2/c1-3-5-7-14-21-27-37-35(25-19-6-4-2)29-30-36(26-20-15-10-8-12-17-23-31-39-33-41)38(37)28-22-16-11-9-13-18-24-32-40-34-42/h35-38H,3-32H2,1-2H3