68443-63-0 Usage
Description
2-Ethylhexanoic Acid N-Butyl Ester, also known as Butyl 2-Ethylhexanoate, is an organic compound that belongs to the ester class. It is characterized by its ester functional group, which is formed by the reaction of an acid (2-ethylhexanoic acid) and an alcohol (n-butanol). 2-ETHYLHEXANOIC ACID N-BUTYL ESTER is known for its unique chemical properties and potential applications in various industries.
Uses
Used in Chemical Synthesis Industry:
2-Ethylhexanoic Acid N-Butyl Ester is used as a reagent in the preparation of triphenylenes in ester solvents. It plays a crucial role in the synthesis process, particularly in the presence of oxidants, which are essential for the formation of the desired triphenylene compounds.
Used in Discotic Liquid Crystals:
2-Ethylhexanoic Acid N-Butyl Ester is utilized as a solvent in the production of discotic liquid crystals. These liquid crystals are known for their unique self-assembling properties and are used in various applications, such as display technologies and sensors.
Used in Organic Electroluminescent Devices:
This ester compound is also employed in the development of organic electroluminescent devices. These devices are known for their high efficiency, low power consumption, and potential use in various applications, such as lighting and displays.
Used in Photoelectric Converters:
2-Ethylhexanoic Acid N-Butyl Ester is used as a component in the fabrication of photoelectric converters. These converters are essential in converting light energy into electrical energy, which can be used in various applications, such as solar cells and photodetectors.
Check Digit Verification of cas no
The CAS Registry Mumber 68443-63-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,4,4 and 3 respectively; the second part has 2 digits, 6 and 3 respectively.
Calculate Digit Verification of CAS Registry Number 68443-63:
(7*6)+(6*8)+(5*4)+(4*4)+(3*3)+(2*6)+(1*3)=150
150 % 10 = 0
So 68443-63-0 is a valid CAS Registry Number.
InChI:InChI=1/C12H24O2/c1-4-7-9-11(6-3)12(13)14-10-8-5-2/h11H,4-10H2,1-3H3
68443-63-0Relevant articles and documents
Cross-Dehydrogenating Coupling of Aldehydes with Amines/R-OTBS Ethers by Visible-Light Photoredox Catalysis: Synthesis of Amides, Esters, and Ureas
Pandey, Ganesh,Koley, Suvajit,Talukdar, Ranadeep,Sahani, Pramod Kumar
supporting information, p. 5861 - 5865 (2018/09/21)
A straightforward synthesis of amides, ureas, and esters is reported by visible-light cross-dehydrogenating coupling (CDC) of aldehydes (or amine carbaldehydes) and amines/R-OTBS ethers by photoredox catalysis. The reaction is found to be general and high yielding. A plausible mechanistic pathway has been proposed for these transformations and is supported by appropriate controlled experiments.