68588-39-6 Usage
General Description
6-Chloro-N-ethylpyridazin-3-amine is an organic compound with the chemical formula C7H10ClN3. It is a derivative of pyridazine and contains a chlorine atom along with an ethyl group attached to the nitrogen atom in the molecule. 6-Chloro-N-ethylpyridazin-3-amine is used in pharmaceutical research and development as a building block for the synthesis of various biologically active molecules. It has also been studied for its potential pharmacological properties, including its role as a potential therapeutic agent against certain diseases. Additionally, it has been investigated for its environmental impact and potential use in agrochemical applications. Overall, 6-Chloro-N-ethylpyridazin-3-amine is a versatile chemical with applications in various fields, including medicine and agriculture.
Check Digit Verification of cas no
The CAS Registry Mumber 68588-39-6 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,5,8 and 8 respectively; the second part has 2 digits, 3 and 9 respectively.
Calculate Digit Verification of CAS Registry Number 68588-39:
(7*6)+(6*8)+(5*5)+(4*8)+(3*8)+(2*3)+(1*9)=186
186 % 10 = 6
So 68588-39-6 is a valid CAS Registry Number.
InChI:InChI=1/C6H8ClN3/c1-2-8-6-4-3-5(7)9-10-6/h3-4H,2H2,1H3,(H,8,10)
