68636-50-0 Usage
Description
4-Aminophenyl 2,3,6-Tri-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl--D-glucopyranosyl)--D-glucopyranoside is a complex organic compound with a unique chemical structure. It is an off-white solid with specific chemical properties that make it suitable for various applications in different industries.
Uses
Used in Biochemical Applications:
4-Aminophenyl 2,3,6-Tri-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl--D-glucopyranosyl)--D-glucopyranoside is used as a functional affinity ligand for the separation of exo-(cellobiohydrolases) and endo-(endoglucanases) acting cellulases. Its unique structure allows for the selective binding and separation of these enzymes, which is crucial in the study and production of cellulases for various industrial applications.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 4-Aminophenyl 2,3,6-Tri-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl--D-glucopyranosyl)--D-glucopyranoside may be used as a key intermediate in the synthesis of various drugs, particularly those targeting carbohydrate-related diseases or conditions. Its unique structure can be exploited to create novel drug candidates with potential therapeutic benefits.
Used in Chemical Research:
4-Aminophenyl 2,3,6-Tri-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl--D-glucopyranosyl)--D-glucopyranoside is also used in chemical research as a model compound for studying the interactions between carbohydrates and other biomolecules. This can lead to a better understanding of carbohydrate biology and the development of new strategies for targeting carbohydrate-related diseases.
Used in Material Science:
In material science, 4-Aminophenyl 2,3,6-Tri-O-acetyl-4-O-(2,3,4,6-tetra-O-acetyl--D-glucopyranosyl)--D-glucopyranoside may be used in the development of novel materials with specific properties, such as improved biocompatibility or enhanced interaction with biological systems. Its unique structure can be incorporated into the design of new materials for various applications, including drug delivery systems and biocompatible coatings.
Check Digit Verification of cas no
The CAS Registry Mumber 68636-50-0 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,6,3 and 6 respectively; the second part has 2 digits, 5 and 0 respectively.
Calculate Digit Verification of CAS Registry Number 68636-50:
(7*6)+(6*8)+(5*6)+(4*3)+(3*6)+(2*5)+(1*0)=160
160 % 10 = 0
So 68636-50-0 is a valid CAS Registry Number.
InChI:InChI=1/C32H41NO17S/c1-14(34)41-12-23-25(43-16(3)36)27(44-17(4)37)29(46-19(6)39)31(48-23)50-26-24(13-42-15(2)35)49-32(51-22-10-8-21(33)9-11-22)30(47-20(7)40)28(26)45-18(5)38/h8-11,23-32H,12-13,33H2,1-7H3/t23?,24?,25-,26-,27+,28+,29+,30+,31+,32+/m1/s1
68636-50-0Relevant articles and documents
Poly-cation salts of bis (or tris) 4-O-polyhexose-thio-arylene sulfate derivatives
-
, (2008/06/13)
Poly-cation salts of bis (or tris) 4-O-polyhexose-thio-arylene sulfate derivatives, useful as modulators of the complement system, the intermediates thereof and the process of making such intermediates and end products.