68922-87-2 Usage
Description
Triethyl Methanetricarboxylate Sodium, with the chemical formula C12H21NaO7 and CAS number 68922-87-2, is an organic compound that plays a significant role in various chemical reactions and processes. It is known for its unique properties and reactivity, making it a valuable component in the synthesis of other organic compounds.
Uses
Used in Organic Synthesis:
Triethyl Methanetricarboxylate Sodium is used as a reagent in organic synthesis for its ability to participate in various chemical reactions. Its presence can facilitate the formation of new compounds and improve the efficiency of certain synthesis processes.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, Triethyl Methanetricarboxylate Sodium is used as an intermediate in the production of various drugs and pharmaceutical compounds. Its unique properties allow it to be a key component in the synthesis of medications that address a wide range of health conditions.
Used in Chemical Research:
Triethyl Methanetricarboxylate Sodium is also utilized in chemical research as a model compound for studying the behavior of organic compounds under different conditions. This helps researchers to better understand the underlying principles of chemical reactions and develop new methods for synthesizing complex molecules.
Used in Material Science:
In the field of material science, Triethyl Methanetricarboxylate Sodium is employed in the development of new materials with specific properties. Its reactivity and ability to form complexes with other compounds make it a valuable component in the creation of advanced materials for various applications.
Check Digit Verification of cas no
The CAS Registry Mumber 68922-87-2 includes 8 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 5 digits, 6,8,9,2 and 2 respectively; the second part has 2 digits, 8 and 7 respectively.
Calculate Digit Verification of CAS Registry Number 68922-87:
(7*6)+(6*8)+(5*9)+(4*2)+(3*2)+(2*8)+(1*7)=172
172 % 10 = 2
So 68922-87-2 is a valid CAS Registry Number.
InChI:InChI=1/C10H15O6.Na/c1-4-14-8(11)7(9(12)15-5-2)10(13)16-6-3;/h4-6H2,1-3H3;/q-1;+1
68922-87-2Relevant articles and documents
When cobalt-mediated [2 + 2 + 2] cycloaddition reaction dares go astray: Synthesis of unprecedented cobalt(III)-complexes
Delorme, Marion,Punter, Alexander,Oliveira, Raquel,Aubert, Corinne,Carissan, Yannick,Parrain, Jean-Luc,Amatore, Muriel,Nava, Paola,Commeiras, Laurent
supporting information, p. 15767 - 15771 (2019/11/11)
In sharp contrast with the standard [2 + 2 + 2] cycloaddition reaction of diyne/ene, cobalt-mediated cycloadditions with γ-alkylidenebutenolide led to unprecedented cobalt(iii) polycyclic complexes. A plausible mechanism supported by a computational study based on an unusual fragmentation of the butenolide moiety was postulated to account for this original reaction.
NOVEL 3, 4-PROPYLENEDIOXYTHIOPHENE DERIVATIVES WITH PENDANT FUNCTIONAL GROUPS
-
Page/Page column 6, (2010/11/24)
The present invention relates to the syntheses of 3,4-propylenedioxythiophenes of the formula (I) wherein R represents a n-valent linear or branched, optionally substituted, aliphatic C1-Cn radical and Y represents a pendant functional group. Further, methods for the preparation of the said compounds are disclosed.
