690632-22-5 Usage
Description
1-(Mesitylmethyl)-1,4-diazepane is a chemical compound with the molecular formula C12H23N. It is a derivative of diazepane, a seven-membered heterocyclic compound containing one nitrogen atom. The mesitylmethyl group is attached to the diazepane ring, providing steric hindrance and influencing the compound's reactivity and stability.
Uses
Used in Organic Synthesis:
1-(Mesitylmethyl)-1,4-diazepane is used as a building block for the synthesis of various organic compounds due to its unique chemical structure and properties.
Used in Pharmaceutical Industry:
1-(Mesitylmethyl)-1,4-diazepane is used as a potential pharmaceutical candidate for the development of new drugs, given its unique chemical structure and properties.
Used in Materials Science:
1-(Mesitylmethyl)-1,4-diazepane is used as a component in the development of new materials with specific properties, such as stability and reactivity, due to its unique chemical structure and properties.
Further research and investigation into the potential uses and reactivity of 1-(Mesitylmethyl)-1,4-diazepane are warranted to fully understand its capabilities and potential benefits.
Check Digit Verification of cas no
The CAS Registry Mumber 690632-22-5 includes 9 digits separated into 3 groups by hyphens. The first part of the number,starting from the left, has 6 digits, 6,9,0,6,3 and 2 respectively; the second part has 2 digits, 2 and 2 respectively.
Calculate Digit Verification of CAS Registry Number 690632-22:
(8*6)+(7*9)+(6*0)+(5*6)+(4*3)+(3*2)+(2*2)+(1*2)=165
165 % 10 = 5
So 690632-22-5 is a valid CAS Registry Number.
InChI:InChI=1/C15H24N2/c1-12-9-13(2)15(14(3)10-12)11-17-7-4-5-16-6-8-17/h9-10,16H,4-8,11H2,1-3H3
